About 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide
1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide (PubChem CID 4079356) has the molecular formula C17H33N3O4S
and a molecular weight of 375.54 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide |
| PubChem CID | 4079356 |
| Molecular Formula | C17H33N3O4S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide |
| SMILES | COCCCNC(=O)C1CCCN(S(=O)(=O)N2CC(C)CC(C)C2)C1 |
| InChI | InChI=1S/C17H33N3O4S/c1-14-10-15(2)12-20(11-14)25(22,23)19-8-4-6-16(13-19)17(21)18-7-5-9-24-3/h14-16H,4-13H2,1-3H3,(H,18,21) |
| InChIKey | MPSPYTKRKOQVHZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide?
The IUPAC name of 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide (CID 4079356) is 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide.
What is the SMILES notation for 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide?
The canonical SMILES for 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide is COCCCNC(=O)C1CCCN(S(=O)(=O)N2CC(C)CC(C)C2)C1.
What is the InChIKey of 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide?
The InChIKey is MPSPYTKRKOQVHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33N3O4S/c1-14-10-15(2)12-20(11-14)25(22,23)19-8-4-6-16(13-19)17(21)18-7-5-9-24-3/h14-16H,4-13H2,1-3H3,(H,18,21).
What are the key properties of 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide?
1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide has a molecular weight of 375.54 g/mol, XLogP of 1.07, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide is sourced from PubChem (CID 4079356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).