C14H22N2O2 — CID 40794639
(2S)-2-(tert-butylamino)-N-(2-methoxyphenyl)propanamide (PubChem CID 40794639) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2S)-2-(tert-butylamino)-N-(2-methoxyphenyl)propanamide.
| Compound Name | (2S)-2-(tert-butylamino)-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 40794639 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (2S)-2-(tert-butylamino)-N-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1NC(=O)[C@H](C)NC(C)(C)C |
| InChI | InChI=1S/C14H22N2O2/c1-10(16-14(2,3)4)13(17)15-11-8-6-7-9-12(11)18-5/h6-10,16H,1-5H3,(H,15,17)/t10-/m0/s1 |
| InChIKey | HXLNUOWOUKUJIK-JTQLQIEISA-N |
| XLogP | 2.41 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |