C24H27N3O5 — CID 40795248
N-[(3,4-dimethoxyphenyl)methyl]-2-[(5R)-2',5'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,4'-imidazolidine]-1'-yl]acetamide (PubChem CID 40795248) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-[(5R)-2',5'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,4'-imidazolidine]-1'-yl]acetamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[(5R)-2',5'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,4'-imidazolidine]-1'-yl]acetamide |
|---|---|
| PubChem CID | 40795248 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[(5R)-2',5'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,4'-imidazolidine]-1'-yl]acetamide |
| SMILES | COc1ccc(CNC(=O)CN2C(=O)N[C@@]3(CCCCc4ccccc43)C2=O)cc1OC |
| InChI | InChI=1S/C24H27N3O5/c1-31-19-11-10-16(13-20(19)32-2)14-25-21(28)15-27-22(29)24(26-23(27)30)12-6-5-8-17-7-3-4-9-18(17)24/h3-4,7,9-11,13H,5-6,8,12,14-15H2,1-2H3,(H,25,28)(H,26,30)/t24-/m1/s1 |
| InChIKey | AFIYVHCFTRUAMM-XMMPIXPASA-N |
| XLogP | 2.49 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|