C24H28N4O5S — CID 40795250
N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2-[(5R)-2',5'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,4'-imidazolidine]-1'-yl]acetamide (PubChem CID 40795250) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2-[(5R)-2',5'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,4'-imidazolidine]-1'-yl]acetamide.
| Compound Name | N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2-[(5R)-2',5'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,4'-imidazolidine]-1'-yl]acetamide |
|---|---|
| PubChem CID | 40795250 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2-[(5R)-2',5'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,4'-imidazolidine]-1'-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)N[C@@]3(CCCCc4ccccc43)C2=O)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C24H28N4O5S/c1-16-11-12-18(14-20(16)34(32,33)27(2)3)25-21(29)15-28-22(30)24(26-23(28)31)13-7-6-9-17-8-4-5-10-19(17)24/h4-5,8,10-12,14H,6-7,9,13,15H2,1-3H3,(H,25,29)(H,26,31)/t24-/m1/s1 |
| InChIKey | UWJUOLHIVJHENY-XMMPIXPASA-N |
| XLogP | 2.36 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|