About N,N'-dibenzylhexanediamide
N,N'-dibenzylhexanediamide (PubChem CID 4079537) has the molecular formula C20H24N2O2
and a molecular weight of 324.42 g/mol. Its IUPAC name is N,N'-dibenzylhexanediamide.
Molecular Properties
| Compound Name | N,N'-dibenzylhexanediamide |
| PubChem CID | 4079537 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N,N'-dibenzylhexanediamide |
| SMILES | O=C(CCCCC(=O)NCc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C20H24N2O2/c23-19(21-15-17-9-3-1-4-10-17)13-7-8-14-20(24)22-16-18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2,(H,21,23)(H,22,24) |
| InChIKey | MFBKELHPKHLNTH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dibenzylhexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dibenzylhexanediamide?
The IUPAC name of N,N'-dibenzylhexanediamide (CID 4079537) is N,N'-dibenzylhexanediamide.
What is the SMILES notation for N,N'-dibenzylhexanediamide?
The canonical SMILES for N,N'-dibenzylhexanediamide is O=C(CCCCC(=O)NCc1ccccc1)NCc1ccccc1.
What is the InChIKey of N,N'-dibenzylhexanediamide?
The InChIKey is MFBKELHPKHLNTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O2/c23-19(21-15-17-9-3-1-4-10-17)13-7-8-14-20(24)22-16-18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2,(H,21,23)(H,22,24).
What are the key properties of N,N'-dibenzylhexanediamide?
N,N'-dibenzylhexanediamide has a molecular weight of 324.42 g/mol, XLogP of 3.18, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dibenzylhexanediamide is sourced from PubChem (CID 4079537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).