C24H32N2O4 — CID 40796762
(2S)-2-(4-methylphenoxy)-N-[2-[[(2S)-2-(4-methylphenoxy)butanoyl]amino]ethyl]butanamide (PubChem CID 40796762) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is (2S)-2-(4-methylphenoxy)-N-[2-[[(2S)-2-(4-methylphenoxy)butanoyl]amino]ethyl]butanamide.
| Compound Name | (2S)-2-(4-methylphenoxy)-N-[2-[[(2S)-2-(4-methylphenoxy)butanoyl]amino]ethyl]butanamide |
|---|---|
| PubChem CID | 40796762 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (2S)-2-(4-methylphenoxy)-N-[2-[[(2S)-2-(4-methylphenoxy)butanoyl]amino]ethyl]butanamide |
| SMILES | CC[C@H](Oc1ccc(C)cc1)C(=O)NCCNC(=O)[C@H](CC)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C24H32N2O4/c1-5-21(29-19-11-7-17(3)8-12-19)23(27)25-15-16-26-24(28)22(6-2)30-20-13-9-18(4)10-14-20/h7-14,21-22H,5-6,15-16H2,1-4H3,(H,25,27)(H,26,28)/t21-,22-/m0/s1 |
| InChIKey | SQOLOCQQDKZPBD-VXKWHMMOSA-N |
| XLogP | 3.55 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|