About 6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one
6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one (PubChem CID 4079978) has the molecular formula C29H26ClN3O
and a molecular weight of 468.00 g/mol. Its IUPAC name is 6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one.
Molecular Properties
| Compound Name | 6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one |
| PubChem CID | 4079978 |
| Molecular Formula | C29H26ClN3O |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one |
| SMILES | Cc1c(Cl)ccc2c1NC(=O)C2(c1c(C)n(C)c2ccccc12)c1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C29H26ClN3O/c1-16-22(30)15-14-21-27(16)31-28(34)29(21,25-17(2)32(4)23-12-8-6-10-19(23)25)26-18(3)33(5)24-13-9-7-11-20(24)26/h6-15H,1-5H3,(H,31,34) |
| InChIKey | OTLNIEXVSFDXQI-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 38.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one?
The IUPAC name of 6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one (CID 4079978) is 6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one.
What is the SMILES notation for 6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one?
The canonical SMILES for 6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one is Cc1c(Cl)ccc2c1NC(=O)C2(c1c(C)n(C)c2ccccc12)c1c(C)n(C)c2ccccc12.
What is the InChIKey of 6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one?
The InChIKey is OTLNIEXVSFDXQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26ClN3O/c1-16-22(30)15-14-21-27(16)31-28(34)29(21,25-17(2)32(4)23-12-8-6-10-19(23)25)26-18(3)33(5)24-13-9-7-11-20(24)26/h6-15H,1-5H3,(H,31,34).
What are the key properties of 6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one?
6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one has a molecular weight of 468.00 g/mol, XLogP of 6.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3,3-bis(1,2-dimethylindol-3-yl)-7-methyl-1H-indol-2-one is sourced from PubChem (CID 4079978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).