About (3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid
(3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid (PubChem CID 40800645) has the molecular formula C11H10FNO2S
and a molecular weight of 239.27 g/mol. Its IUPAC name is (3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid |
| PubChem CID | 40800645 |
| Molecular Formula | C11H10FNO2S |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | (3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CSCC(c2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C11H10FNO2S/c12-8-3-1-7(2-4-8)9-5-16-6-10(13-9)11(14)15/h1-4,10H,5-6H2,(H,14,15)/t10-/m1/s1 |
| InChIKey | MFWDMTMCKPRRDU-SNVBAGLBSA-N |
| XLogP | 1.81 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid?
The IUPAC name of (3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid (CID 40800645) is (3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid.
What is the SMILES notation for (3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid?
The canonical SMILES for (3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid is O=C(O)[C@H]1CSCC(c2ccc(F)cc2)=N1.
What is the InChIKey of (3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid?
The InChIKey is MFWDMTMCKPRRDU-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H10FNO2S/c12-8-3-1-7(2-4-8)9-5-16-6-10(13-9)11(14)15/h1-4,10H,5-6H2,(H,14,15)/t10-/m1/s1.
What are the key properties of (3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid?
(3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid has a molecular weight of 239.27 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid is sourced from PubChem (CID 40800645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).