About ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate
ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 4080136) has the molecular formula C18H19N3O2S
and a molecular weight of 341.44 g/mol. Its IUPAC name is ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate |
| PubChem CID | 4080136 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2nc(C)nc(NCc3ccccc3)c2c1C |
| InChI | InChI=1S/C18H19N3O2S/c1-4-23-18(22)15-11(2)14-16(20-12(3)21-17(14)24-15)19-10-13-8-6-5-7-9-13/h5-9H,4,10H2,1-3H3,(H,19,20,21) |
| InChIKey | SODMBVYLWHGAFJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate?
The IUPAC name of ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate (CID 4080136) is ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate.
What is the SMILES notation for ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate?
The canonical SMILES for ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate is CCOC(=O)c1sc2nc(C)nc(NCc3ccccc3)c2c1C.
What is the InChIKey of ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate?
The InChIKey is SODMBVYLWHGAFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O2S/c1-4-23-18(22)15-11(2)14-16(20-12(3)21-17(14)24-15)19-10-13-8-6-5-7-9-13/h5-9H,4,10H2,1-3H3,(H,19,20,21).
What are the key properties of ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate?
ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate has a molecular weight of 341.44 g/mol, XLogP of 4.10, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(benzylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 4080136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).