C15H11N3O4 — CID 40805087
3-nitro-N-(2-oxo-1,3-dihydroindol-5-yl)benzamide (PubChem CID 40805087) has the molecular formula C15H11N3O4 and a molecular weight of 297.27 g/mol. Its IUPAC name is 3-nitro-N-(2-oxo-1,3-dihydroindol-5-yl)benzamide.
| Compound Name | 3-nitro-N-(2-oxo-1,3-dihydroindol-5-yl)benzamide |
|---|---|
| PubChem CID | 40805087 |
| Molecular Formula | C15H11N3O4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3-nitro-N-(2-oxo-1,3-dihydroindol-5-yl)benzamide |
| SMILES | O=C1Cc2cc(NC(=O)c3cccc([N+](=O)[O-])c3)ccc2N1 |
| InChI | InChI=1S/C15H11N3O4/c19-14-8-10-6-11(4-5-13(10)17-14)16-15(20)9-2-1-3-12(7-9)18(21)22/h1-7H,8H2,(H,16,20)(H,17,19) |
| InChIKey | DJIIFSGSSDRZBP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|