C16H17N3O2 — CID 4080719
N-[1-(3-aminophenyl)ethylideneamino]-2-hydroxy-2-phenylacetamide (PubChem CID 4080719) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-[1-(3-aminophenyl)ethylideneamino]-2-hydroxy-2-phenylacetamide.
| Compound Name | N-[1-(3-aminophenyl)ethylideneamino]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 4080719 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-[1-(3-aminophenyl)ethylideneamino]-2-hydroxy-2-phenylacetamide |
| SMILES | CC(=NNC(=O)C(O)c1ccccc1)c1cccc(N)c1 |
| InChI | InChI=1S/C16H17N3O2/c1-11(13-8-5-9-14(17)10-13)18-19-16(21)15(20)12-6-3-2-4-7-12/h2-10,15,20H,17H2,1H3,(H,19,21) |
| InChIKey | GIVXGIFNRLBMCB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|