C25H29N5S — CID 40809026
4-[2,5-dimethyl-1-[(1R)-1-phenylethyl]pyrrol-3-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3-thiazole (PubChem CID 40809026) has the molecular formula C25H29N5S and a molecular weight of 431.61 g/mol. Its IUPAC name is 4-[2,5-dimethyl-1-[(1R)-1-phenylethyl]pyrrol-3-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3-thiazole.
| Compound Name | 4-[2,5-dimethyl-1-[(1R)-1-phenylethyl]pyrrol-3-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 40809026 |
| Molecular Formula | C25H29N5S |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 4-[2,5-dimethyl-1-[(1R)-1-phenylethyl]pyrrol-3-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3-thiazole |
| SMILES | Cc1cc(-c2csc(Cc3nnc4n3CCCCC4)n2)c(C)n1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C25H29N5S/c1-17-14-21(19(3)30(17)18(2)20-10-6-4-7-11-20)22-16-31-25(26-22)15-24-28-27-23-12-8-5-9-13-29(23)24/h4,6-7,10-11,14,16,18H,5,8-9,12-13,15H2,1-3H3/t18-/m1/s1 |
| InChIKey | SQTRLROLBGHQGF-GOSISDBHSA-N |
| XLogP | 5.75 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |