C28H37N3O5 — CID 4080916
N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-3-(3-hydroxypropyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 4080916) has the molecular formula C28H37N3O5 and a molecular weight of 495.62 g/mol. Its IUPAC name is N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-3-(3-hydroxypropyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-3-(3-hydroxypropyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 4080916 |
| Molecular Formula | C28H37N3O5 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-3-(3-hydroxypropyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCOC1OC(C(=O)NCCCCC(=O)Nc2ccccc2N)=CC(c2ccccc2)C1CCCO |
| InChI | InChI=1S/C28H37N3O5/c1-2-35-28-21(13-10-18-32)22(20-11-4-3-5-12-20)19-25(36-28)27(34)30-17-9-8-16-26(33)31-24-15-7-6-14-23(24)29/h3-7,11-12,14-15,19,21-22,28,32H,2,8-10,13,16-18,29H2,1H3,(H,30,34)(H,31,33) |
| InChIKey | NICTXGBXARBDEF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|