C24H18F2N2O4S — CID 4080997
2-[[2-(3,4-difluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 4080997) has the molecular formula C24H18F2N2O4S and a molecular weight of 468.48 g/mol. Its IUPAC name is 2-[[2-(3,4-difluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[2-(3,4-difluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4080997 |
| Molecular Formula | C24H18F2N2O4S |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 2-[[2-(3,4-difluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC1c2ccccc2CCN1S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C24H18F2N2O4S/c25-20-10-9-16(13-21(20)26)33(31,32)28-12-11-15-5-1-2-6-17(15)22(28)14-27-23(29)18-7-3-4-8-19(18)24(27)30/h1-10,13,22H,11-12,14H2 |
| InChIKey | NGRCWQTYXZBGIZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|