C27H27NO6 — CID 40810178
benzyl (4R)-2-amino-4-(2-butoxyphenyl)-7-methyl-5-oxo-4H-pyrano[3,2-c]pyran-3-carboxylate (PubChem CID 40810178) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is benzyl (4R)-2-amino-4-(2-butoxyphenyl)-7-methyl-5-oxo-4H-pyrano[3,2-c]pyran-3-carboxylate.
| Compound Name | benzyl (4R)-2-amino-4-(2-butoxyphenyl)-7-methyl-5-oxo-4H-pyrano[3,2-c]pyran-3-carboxylate |
|---|---|
| PubChem CID | 40810178 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | benzyl (4R)-2-amino-4-(2-butoxyphenyl)-7-methyl-5-oxo-4H-pyrano[3,2-c]pyran-3-carboxylate |
| SMILES | CCCCOc1ccccc1[C@H]1C(C(=O)OCc2ccccc2)=C(N)Oc2cc(C)oc(=O)c21 |
| InChI | InChI=1S/C27H27NO6/c1-3-4-14-31-20-13-9-8-12-19(20)22-23-21(15-17(2)33-27(23)30)34-25(28)24(22)26(29)32-16-18-10-6-5-7-11-18/h5-13,15,22H,3-4,14,16,28H2,1-2H3/t22-/m1/s1 |
| InChIKey | DIIBOMKFBXNXFN-JOCHJYFZSA-N |
| XLogP | 4.57 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|