C19H17Cl2NO7 — CID 40810284
2-methoxyethyl (4S)-2-amino-4-(2,3-dichlorophenyl)-6-(hydroxymethyl)-8-oxo-4H-pyrano[3,2-b]pyran-3-carboxylate (PubChem CID 40810284) has the molecular formula C19H17Cl2NO7 and a molecular weight of 442.25 g/mol. Its IUPAC name is 2-methoxyethyl (4S)-2-amino-4-(2,3-dichlorophenyl)-6-(hydroxymethyl)-8-oxo-4H-pyrano[3,2-b]pyran-3-carboxylate.
| Compound Name | 2-methoxyethyl (4S)-2-amino-4-(2,3-dichlorophenyl)-6-(hydroxymethyl)-8-oxo-4H-pyrano[3,2-b]pyran-3-carboxylate |
|---|---|
| PubChem CID | 40810284 |
| Molecular Formula | C19H17Cl2NO7 |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 2-methoxyethyl (4S)-2-amino-4-(2,3-dichlorophenyl)-6-(hydroxymethyl)-8-oxo-4H-pyrano[3,2-b]pyran-3-carboxylate |
| SMILES | COCCOC(=O)C1=C(N)Oc2c(oc(CO)cc2=O)[C@@H]1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H17Cl2NO7/c1-26-5-6-27-19(25)14-13(10-3-2-4-11(20)15(10)21)17-16(29-18(14)22)12(24)7-9(8-23)28-17/h2-4,7,13,23H,5-6,8,22H2,1H3/t13-/m1/s1 |
| InChIKey | IFIPSKHMLSKHCH-CYBMUJFWSA-N |
| XLogP | 2.32 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|