C16H21N5O2S — CID 40810513
(2S)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]propanamide (PubChem CID 40810513) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is (2S)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]propanamide.
| Compound Name | (2S)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 40810513 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (2S)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]propanamide |
| SMILES | Cc1ccccc1-n1nnnc1S[C@@H](C)C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H21N5O2S/c1-11-6-3-4-8-14(11)21-16(18-19-20-21)24-12(2)15(22)17-10-13-7-5-9-23-13/h3-4,6,8,12-13H,5,7,9-10H2,1-2H3,(H,17,22)/t12-,13-/m0/s1 |
| InChIKey | LGFXTYBCGDGILK-STQMWFEESA-N |
| XLogP | 1.75 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |