About N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide
N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide (PubChem CID 4081068) has the molecular formula C14H14FNO4S
and a molecular weight of 311.33 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide |
| PubChem CID | 4081068 |
| Molecular Formula | C14H14FNO4S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C14H14FNO4S/c1-19-12-7-8-13(20-2)14(9-12)21(17,18)16-11-5-3-10(15)4-6-11/h3-9,16H,1-2H3 |
| InChIKey | CYZHSUYSJMKOIZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide?
The IUPAC name of N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide (CID 4081068) is N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide.
What is the SMILES notation for N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide?
The canonical SMILES for N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide is COc1ccc(OC)c(S(=O)(=O)Nc2ccc(F)cc2)c1.
What is the InChIKey of N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide?
The InChIKey is CYZHSUYSJMKOIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FNO4S/c1-19-12-7-8-13(20-2)14(9-12)21(17,18)16-11-5-3-10(15)4-6-11/h3-9,16H,1-2H3.
What are the key properties of N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide?
N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide has a molecular weight of 311.33 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-2,5-dimethoxybenzenesulfonamide is sourced from PubChem (CID 4081068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).