About ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate
ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate (PubChem CID 40810957) has the molecular formula C18H18N2O5
and a molecular weight of 342.35 g/mol. Its IUPAC name is ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate |
| PubChem CID | 40810957 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1ccoc1CN1C(=O)N[C@](C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H18N2O5/c1-3-24-15(21)13-9-10-25-14(13)11-20-16(22)18(2,19-17(20)23)12-7-5-4-6-8-12/h4-10H,3,11H2,1-2H3,(H,19,23)/t18-/m1/s1 |
| InChIKey | GKAIZKAPAPBVGP-GOSISDBHSA-N |
| XLogP | 2.42 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate?
The IUPAC name of ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate (CID 40810957) is ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate.
What is the SMILES notation for ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate?
The canonical SMILES for ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate is CCOC(=O)c1ccoc1CN1C(=O)N[C@](C)(c2ccccc2)C1=O.
What is the InChIKey of ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate?
The InChIKey is GKAIZKAPAPBVGP-GOSISDBHSA-N. The full InChI is InChI=1S/C18H18N2O5/c1-3-24-15(21)13-9-10-25-14(13)11-20-16(22)18(2,19-17(20)23)12-7-5-4-6-8-12/h4-10H,3,11H2,1-2H3,(H,19,23)/t18-/m1/s1.
What are the key properties of ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate?
ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate has a molecular weight of 342.35 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate is sourced from PubChem (CID 40810957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).