C23H17ClN2O2 — CID 4081221
4-(benzyliminomethyl)-2-(2-chlorophenyl)-3-hydroxyisoquinolin-1-one (PubChem CID 4081221) has the molecular formula C23H17ClN2O2 and a molecular weight of 388.85 g/mol. Its IUPAC name is 4-(benzyliminomethyl)-2-(2-chlorophenyl)-3-hydroxyisoquinolin-1-one.
| Compound Name | 4-(benzyliminomethyl)-2-(2-chlorophenyl)-3-hydroxyisoquinolin-1-one |
|---|---|
| PubChem CID | 4081221 |
| Molecular Formula | C23H17ClN2O2 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 4-(benzyliminomethyl)-2-(2-chlorophenyl)-3-hydroxyisoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(/C=N/Cc2ccccc2)c(O)n1-c1ccccc1Cl |
| InChI | InChI=1S/C23H17ClN2O2/c24-20-12-6-7-13-21(20)26-22(27)18-11-5-4-10-17(18)19(23(26)28)15-25-14-16-8-2-1-3-9-16/h1-13,15,28H,14H2/b25-15+ |
| InChIKey | RGXAJVPUIYIWGS-MFKUBSTISA-N |
| XLogP | 4.97 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|