C28H29N3O3 — CID 40812287
(4S)-1-(2-methoxyphenyl)-4-[1-(4-phenoxybutyl)benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 40812287) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is (4S)-1-(2-methoxyphenyl)-4-[1-(4-phenoxybutyl)benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | (4S)-1-(2-methoxyphenyl)-4-[1-(4-phenoxybutyl)benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 40812287 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | (4S)-1-(2-methoxyphenyl)-4-[1-(4-phenoxybutyl)benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | COc1ccccc1N1C[C@@H](c2nc3ccccc3n2CCCCOc2ccccc2)CC1=O |
| InChI | InChI=1S/C28H29N3O3/c1-33-26-16-8-7-15-25(26)31-20-21(19-27(31)32)28-29-23-13-5-6-14-24(23)30(28)17-9-10-18-34-22-11-3-2-4-12-22/h2-8,11-16,21H,9-10,17-20H2,1H3/t21-/m0/s1 |
| InChIKey | GKTFYPJLEGNXRG-NRFANRHFSA-N |
| XLogP | 5.42 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|