C29H20N4O — CID 40814369
(2S)-6-benzyl-2-phenyl-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaene (PubChem CID 40814369) has the molecular formula C29H20N4O and a molecular weight of 440.51 g/mol. Its IUPAC name is (2S)-6-benzyl-2-phenyl-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaene.
| Compound Name | (2S)-6-benzyl-2-phenyl-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaene |
|---|---|
| PubChem CID | 40814369 |
| Molecular Formula | C29H20N4O |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (2S)-6-benzyl-2-phenyl-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaene |
| SMILES | c1ccc(Cc2nc3c4c(ncn3n2)Oc2c(ccc3ccccc23)[C@@H]4c2ccccc2)cc1 |
| InChI | InChI=1S/C29H20N4O/c1-3-9-19(10-4-1)17-24-31-28-26-25(21-12-5-2-6-13-21)23-16-15-20-11-7-8-14-22(20)27(23)34-29(26)30-18-33(28)32-24/h1-16,18,25H,17H2/t25-/m0/s1 |
| InChIKey | KDOVSRLONODAPQ-VWLOTQADSA-N |
| XLogP | 6.15 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |