C28H29N5O4 — CID 40814603
(4S)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-6-oxo-N-(4-phenoxyphenyl)-4,5-dihydro-1H-pyrimidine-4-carboxamide (PubChem CID 40814603) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is (4S)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-6-oxo-N-(4-phenoxyphenyl)-4,5-dihydro-1H-pyrimidine-4-carboxamide.
| Compound Name | (4S)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-6-oxo-N-(4-phenoxyphenyl)-4,5-dihydro-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 40814603 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | (4S)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-6-oxo-N-(4-phenoxyphenyl)-4,5-dihydro-1H-pyrimidine-4-carboxamide |
| SMILES | COc1ccc(N2CCN(C3=N[C@H](C(=O)Nc4ccc(Oc5ccccc5)cc4)CC(=O)N3)CC2)cc1 |
| InChI | InChI=1S/C28H29N5O4/c1-36-22-13-9-21(10-14-22)32-15-17-33(18-16-32)28-30-25(19-26(34)31-28)27(35)29-20-7-11-24(12-8-20)37-23-5-3-2-4-6-23/h2-14,25H,15-19H2,1H3,(H,29,35)(H,30,31,34)/t25-/m0/s1 |
| InChIKey | WDJWXXJGWJKOAR-VWLOTQADSA-N |
| XLogP | 3.49 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|