About (2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole
(2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole (PubChem CID 40815975) has the molecular formula C9H10BrN
and a molecular weight of 212.09 g/mol. Its IUPAC name is (2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | (2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole |
| PubChem CID | 40815975 |
| Molecular Formula | C9H10BrN |
| Molecular Weight | 212.09 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | (2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole |
| SMILES | C[C@H]1Cc2cc(Br)ccc2N1 |
| InChI | InChI=1S/C9H10BrN/c1-6-4-7-5-8(10)2-3-9(7)11-6/h2-3,5-6,11H,4H2,1H3/t6-/m0/s1 |
| InChIKey | NSBOZWGQLGHLQZ-LURJTMIESA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.09 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole?
The IUPAC name of (2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole (CID 40815975) is (2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole.
What is the SMILES notation for (2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole?
The canonical SMILES for (2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole is C[C@H]1Cc2cc(Br)ccc2N1.
What is the InChIKey of (2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole?
The InChIKey is NSBOZWGQLGHLQZ-LURJTMIESA-N. The full InChI is InChI=1S/C9H10BrN/c1-6-4-7-5-8(10)2-3-9(7)11-6/h2-3,5-6,11H,4H2,1H3/t6-/m0/s1.
What are the key properties of (2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole?
(2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole has a molecular weight of 212.09 g/mol, XLogP of 2.81, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-bromo-2-methyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 40815975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).