C27H33N3O2 — CID 40816519
(3S)-1-[3-(1H-indol-3-yl)propanoyl]-N-[(2R)-4-phenylbutan-2-yl]piperidine-3-carboxamide (PubChem CID 40816519) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is (3S)-1-[3-(1H-indol-3-yl)propanoyl]-N-[(2R)-4-phenylbutan-2-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[3-(1H-indol-3-yl)propanoyl]-N-[(2R)-4-phenylbutan-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 40816519 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | (3S)-1-[3-(1H-indol-3-yl)propanoyl]-N-[(2R)-4-phenylbutan-2-yl]piperidine-3-carboxamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)[C@H]1CCCN(C(=O)CCc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C27H33N3O2/c1-20(13-14-21-8-3-2-4-9-21)29-27(32)23-10-7-17-30(19-23)26(31)16-15-22-18-28-25-12-6-5-11-24(22)25/h2-6,8-9,11-12,18,20,23,28H,7,10,13-17,19H2,1H3,(H,29,32)/t20-,23+/m1/s1 |
| InChIKey | QDNHCZWKKOXVHF-OFNKIYASSA-N |
| XLogP | 4.48 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |