C20H24N2O3S — CID 40819169
N-[2-[(2R)-butan-2-yl]phenyl]-4-(cyclopropylsulfamoyl)benzamide (PubChem CID 40819169) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[2-[(2R)-butan-2-yl]phenyl]-4-(cyclopropylsulfamoyl)benzamide.
| Compound Name | N-[2-[(2R)-butan-2-yl]phenyl]-4-(cyclopropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 40819169 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[2-[(2R)-butan-2-yl]phenyl]-4-(cyclopropylsulfamoyl)benzamide |
| SMILES | CC[C@@H](C)c1ccccc1NC(=O)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-3-14(2)18-6-4-5-7-19(18)21-20(23)15-8-12-17(13-9-15)26(24,25)22-16-10-11-16/h4-9,12-14,16,22H,3,10-11H2,1-2H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | PVBXKAOUOICXRC-CQSZACIVSA-N |
| XLogP | 3.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |