C13H13ClN2O2 — CID 40819368
methyl (2S,4R,5R)-5-(3-chlorophenyl)-4-cyanopyrrolidine-2-carboxylate (PubChem CID 40819368) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is methyl (2S,4R,5R)-5-(3-chlorophenyl)-4-cyanopyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R,5R)-5-(3-chlorophenyl)-4-cyanopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 40819368 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | methyl (2S,4R,5R)-5-(3-chlorophenyl)-4-cyanopyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](C#N)[C@H](c2cccc(Cl)c2)N1 |
| InChI | InChI=1S/C13H13ClN2O2/c1-18-13(17)11-6-9(7-15)12(16-11)8-3-2-4-10(14)5-8/h2-5,9,11-12,16H,6H2,1H3/t9-,11-,12-/m0/s1 |
| InChIKey | KGSXCTBYKMQVMH-DLOVCJGASA-N |
| XLogP | 2.06 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |