C10H14ClNO4S2 — CID 40820270
methyl (2R)-2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-methylbutanoate (PubChem CID 40820270) has the molecular formula C10H14ClNO4S2 and a molecular weight of 311.81 g/mol. Its IUPAC name is methyl (2R)-2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-methylbutanoate.
| Compound Name | methyl (2R)-2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 40820270 |
| Molecular Formula | C10H14ClNO4S2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | methyl (2R)-2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-methylbutanoate |
| SMILES | COC(=O)[C@H](NS(=O)(=O)c1ccc(Cl)s1)C(C)C |
| InChI | InChI=1S/C10H14ClNO4S2/c1-6(2)9(10(13)16-3)12-18(14,15)8-5-4-7(11)17-8/h4-6,9,12H,1-3H3/t9-/m1/s1 |
| InChIKey | LRARODRVRVOIAO-SECBINFHSA-N |
| XLogP | 1.88 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |