C17H12F10Si — CID 4082103
dimethyl-(2,3,4,5,6-pentafluorophenyl)-[3-(2,3,4,5,6-pentafluorophenyl)propyl]silane (PubChem CID 4082103) has the molecular formula C17H12F10Si and a molecular weight of 434.35 g/mol. Its IUPAC name is dimethyl-(2,3,4,5,6-pentafluorophenyl)-[3-(2,3,4,5,6-pentafluorophenyl)propyl]silane.
| Compound Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-[3-(2,3,4,5,6-pentafluorophenyl)propyl]silane |
|---|---|
| PubChem CID | 4082103 |
| Molecular Formula | C17H12F10Si |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-[3-(2,3,4,5,6-pentafluorophenyl)propyl]silane |
| SMILES | C[Si](C)(CCCc1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H12F10Si/c1-28(2,17-15(26)13(24)12(23)14(25)16(17)27)5-3-4-6-7(18)9(20)11(22)10(21)8(6)19/h3-5H2,1-2H3 |
| InChIKey | TWGUTXODLIYIKU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|