C14H23ClN2O2S2 — CID 4082154
5-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]thiophene-2-sulfonamide (PubChem CID 4082154) has the molecular formula C14H23ClN2O2S2 and a molecular weight of 350.94 g/mol. Its IUPAC name is 5-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4082154 |
| Molecular Formula | C14H23ClN2O2S2 |
| Molecular Weight | 350.94 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 5-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]thiophene-2-sulfonamide |
| SMILES | CC1CC(C)CN(CCCNS(=O)(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C14H23ClN2O2S2/c1-11-8-12(2)10-17(9-11)7-3-6-16-21(18,19)14-5-4-13(15)20-14/h4-5,11-12,16H,3,6-10H2,1-2H3 |
| InChIKey | UUNHHIDZCRJMAP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.94 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|