About [(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate
[(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate (PubChem CID 40822602) has the molecular formula C22H25N3O7S
and a molecular weight of 475.52 g/mol. Its IUPAC name is [(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate.
Molecular Properties
| Compound Name | [(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate |
| PubChem CID | 40822602 |
| Molecular Formula | C22H25N3O7S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | [(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)O/N=C2\CCCC[C@@H]2c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H25N3O7S/c1-22(2,3)15-8-11-17(12-9-15)33(30,31)32-23-20-7-5-4-6-18(20)19-13-10-16(24(26)27)14-21(19)25(28)29/h8-14,18H,4-7H2,1-3H3/b23-20+/t18-/m1/s1 |
| InChIKey | GGTADLAAPJFJSF-HLNJFSBGSA-N |
| XLogP | 5.22 |
| TPSA | 142.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate?
The IUPAC name of [(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate (CID 40822602) is [(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate.
What is the SMILES notation for [(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate?
The canonical SMILES for [(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate is CC(C)(C)c1ccc(S(=O)(=O)O/N=C2\CCCC[C@@H]2c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1.
What is the InChIKey of [(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate?
The InChIKey is GGTADLAAPJFJSF-HLNJFSBGSA-N. The full InChI is InChI=1S/C22H25N3O7S/c1-22(2,3)15-8-11-17(12-9-15)33(30,31)32-23-20-7-5-4-6-18(20)19-13-10-16(24(26)27)14-21(19)25(28)29/h8-14,18H,4-7H2,1-3H3/b23-20+/t18-/m1/s1.
What are the key properties of [(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate?
[(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate has a molecular weight of 475.52 g/mol, XLogP of 5.22, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[(2R)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-tert-butylbenzenesulfonate is sourced from PubChem (CID 40822602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).