C21H20ClF3N4O4 — CID 40822649
(3S,3aR,6aR)-5-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-(4-methoxyphenyl)-2-methyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 40822649) has the molecular formula C21H20ClF3N4O4 and a molecular weight of 484.86 g/mol. Its IUPAC name is (3S,3aR,6aR)-5-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-(4-methoxyphenyl)-2-methyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aR,6aR)-5-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-(4-methoxyphenyl)-2-methyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 40822649 |
| Molecular Formula | C21H20ClF3N4O4 |
| Molecular Weight | 484.86 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | (3S,3aR,6aR)-5-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-(4-methoxyphenyl)-2-methyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1ccc([C@@H]2[C@H]3C(=O)N(CCNc4ncc(C(F)(F)F)cc4Cl)C(=O)[C@@H]3ON2C)cc1 |
| InChI | InChI=1S/C21H20ClF3N4O4/c1-28-16(11-3-5-13(32-2)6-4-11)15-17(33-28)20(31)29(19(15)30)8-7-26-18-14(22)9-12(10-27-18)21(23,24)25/h3-6,9-10,15-17H,7-8H2,1-2H3,(H,26,27)/t15-,16-,17-/m1/s1 |
| InChIKey | OFHVCFCZKMVWME-BRWVUGGUSA-N |
| XLogP | 3.15 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.86 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|