C18H25NO2 — CID 40823192
(1R,4aS,8aR)-1-(4-prop-2-enoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-4a-ol (PubChem CID 40823192) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (1R,4aS,8aR)-1-(4-prop-2-enoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-4a-ol.
| Compound Name | (1R,4aS,8aR)-1-(4-prop-2-enoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-4a-ol |
|---|---|
| PubChem CID | 40823192 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (1R,4aS,8aR)-1-(4-prop-2-enoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-4a-ol |
| SMILES | C=CCOc1ccc([C@@H]2NCC[C@@]3(O)CCCC[C@H]23)cc1 |
| InChI | InChI=1S/C18H25NO2/c1-2-13-21-15-8-6-14(7-9-15)17-16-5-3-4-10-18(16,20)11-12-19-17/h2,6-9,16-17,19-20H,1,3-5,10-13H2/t16-,17+,18+/m1/s1 |
| InChIKey | IZIPJUDDGSBLQV-SQNIBIBYSA-N |
| XLogP | 3.21 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|