C23H21ClN4O4 — CID 40825722
2-[(1R,3R,3aR,6aS)-7'-chloro-2',4,6-trioxo-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]acetamide (PubChem CID 40825722) has the molecular formula C23H21ClN4O4 and a molecular weight of 452.90 g/mol. Its IUPAC name is 2-[(1R,3R,3aR,6aS)-7'-chloro-2',4,6-trioxo-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]acetamide.
| Compound Name | 2-[(1R,3R,3aR,6aS)-7'-chloro-2',4,6-trioxo-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]acetamide |
|---|---|
| PubChem CID | 40825722 |
| Molecular Formula | C23H21ClN4O4 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 2-[(1R,3R,3aR,6aS)-7'-chloro-2',4,6-trioxo-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]acetamide |
| SMILES | NC(=O)C[C@H]1N[C@]2(C(=O)Nc3c(Cl)cccc32)[C@@H]2C(=O)N(CCc3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C23H21ClN4O4/c24-14-8-4-7-13-19(14)26-22(32)23(13)18-17(15(27-23)11-16(25)29)20(30)28(21(18)31)10-9-12-5-2-1-3-6-12/h1-8,15,17-18,27H,9-11H2,(H2,25,29)(H,26,32)/t15-,17-,18+,23+/m1/s1 |
| InChIKey | FOXOTUJWTVHLJC-VGHKVXAASA-N |
| XLogP | 1.18 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|