C28H30N4O3 — CID 40826243
(2S,11S)-N-[(2S,3R)-1-(cyclopropylamino)-3-methyl-1-oxopentan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide (PubChem CID 40826243) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is (2S,11S)-N-[(2S,3R)-1-(cyclopropylamino)-3-methyl-1-oxopentan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide.
| Compound Name | (2S,11S)-N-[(2S,3R)-1-(cyclopropylamino)-3-methyl-1-oxopentan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
|---|---|
| PubChem CID | 40826243 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | (2S,11S)-N-[(2S,3R)-1-(cyclopropylamino)-3-methyl-1-oxopentan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
| SMILES | CC[C@@H](C)[C@H](NC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H]2c3ccccc3C(=O)N21)C(=O)NC1CC1 |
| InChI | InChI=1S/C28H30N4O3/c1-3-15(2)23(27(34)29-16-12-13-16)31-26(33)22-14-20-17-8-6-7-11-21(17)30-24(20)25-18-9-4-5-10-19(18)28(35)32(22)25/h4-11,15-16,22-23,25,30H,3,12-14H2,1-2H3,(H,29,34)(H,31,33)/t15-,22+,23+,25+/m1/s1 |
| InChIKey | UQKXOZMHNISVTL-NHVFDXCNSA-N |
| XLogP | 3.45 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|