C32H26N4O3 — CID 40830884
N-[(E)-[(3aS,7aR)-2-oxo-3a,7a-dihydro-1H-indol-3-ylidene]amino]-2-[4-(6-methyl-4-phenylquinolin-2-yl)phenoxy]acetamide (PubChem CID 40830884) has the molecular formula C32H26N4O3 and a molecular weight of 514.59 g/mol. Its IUPAC name is N-[(E)-[(3aS,7aR)-2-oxo-3a,7a-dihydro-1H-indol-3-ylidene]amino]-2-[4-(6-methyl-4-phenylquinolin-2-yl)phenoxy]acetamide.
| Compound Name | N-[(E)-[(3aS,7aR)-2-oxo-3a,7a-dihydro-1H-indol-3-ylidene]amino]-2-[4-(6-methyl-4-phenylquinolin-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 40830884 |
| Molecular Formula | C32H26N4O3 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | N-[(E)-[(3aS,7aR)-2-oxo-3a,7a-dihydro-1H-indol-3-ylidene]amino]-2-[4-(6-methyl-4-phenylquinolin-2-yl)phenoxy]acetamide |
| SMILES | Cc1ccc2nc(-c3ccc(OCC(=O)N/N=C4/C(=O)N[C@@H]5C=CC=C[C@H]45)cc3)cc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C32H26N4O3/c1-20-11-16-28-26(17-20)25(21-7-3-2-4-8-21)18-29(33-28)22-12-14-23(15-13-22)39-19-30(37)35-36-31-24-9-5-6-10-27(24)34-32(31)38/h2-18,24,27H,19H2,1H3,(H,34,38)(H,35,37)/b36-31+/t24-,27+/m0/s1 |
| InChIKey | XVGRVVKQEFZSKR-CTBCTLBNSA-N |
| XLogP | 4.97 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|