C19H30Cl4N2O2 — CID 4083493
2,2-dichloro-N-[9-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]nonyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 4083493) has the molecular formula C19H30Cl4N2O2 and a molecular weight of 460.27 g/mol. Its IUPAC name is 2,2-dichloro-N-[9-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]nonyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[9-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]nonyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 4083493 |
| Molecular Formula | C19H30Cl4N2O2 |
| Molecular Weight | 460.27 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 2,2-dichloro-N-[9-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]nonyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)NCCCCCCCCCNC(=O)C2(C)CC2(Cl)Cl)CC1(Cl)Cl |
| InChI | InChI=1S/C19H30Cl4N2O2/c1-16(12-18(16,20)21)14(26)24-10-8-6-4-3-5-7-9-11-25-15(27)17(2)13-19(17,22)23/h3-13H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | MQYFVUPOBYAPOW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.27 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|