C23H26N4O3S — CID 40835278
(5S)-1-[3-(dimethylamino)propyl]-4-[(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)-hydroxymethylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 40835278) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is (5S)-1-[3-(dimethylamino)propyl]-4-[(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)-hydroxymethylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (5S)-1-[3-(dimethylamino)propyl]-4-[(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)-hydroxymethylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 40835278 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (5S)-1-[3-(dimethylamino)propyl]-4-[(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)-hydroxymethylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | Cc1nc2c(C)cccn2c1C(O)=C1C(=O)C(=O)N(CCCN(C)C)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C23H26N4O3S/c1-14-8-5-11-26-18(15(2)24-22(14)26)20(28)17-19(16-9-6-13-31-16)27(23(30)21(17)29)12-7-10-25(3)4/h5-6,8-9,11,13,19,28H,7,10,12H2,1-4H3/t19-/m1/s1 |
| InChIKey | QWMFWRGUUXELAV-LJQANCHMSA-N |
| XLogP | 3.39 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|