C26H33N3O7 — CID 40835777
methyl 4-[[(2R)-2-(2,3-dimethoxyphenyl)-1-[3-(dimethylamino)propyl]-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 40835777) has the molecular formula C26H33N3O7 and a molecular weight of 499.56 g/mol. Its IUPAC name is methyl 4-[[(2R)-2-(2,3-dimethoxyphenyl)-1-[3-(dimethylamino)propyl]-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[[(2R)-2-(2,3-dimethoxyphenyl)-1-[3-(dimethylamino)propyl]-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 40835777 |
| Molecular Formula | C26H33N3O7 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | methyl 4-[[(2R)-2-(2,3-dimethoxyphenyl)-1-[3-(dimethylamino)propyl]-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c(C)c(C(O)=C2C(=O)C(=O)N(CCCN(C)C)[C@@H]2c2cccc(OC)c2OC)c1C |
| InChI | InChI=1S/C26H33N3O7/c1-14-18(15(2)27-20(14)26(33)36-7)22(30)19-21(16-10-8-11-17(34-5)24(16)35-6)29(25(32)23(19)31)13-9-12-28(3)4/h8,10-11,21,27,30H,9,12-13H2,1-7H3/t21-/m1/s1 |
| InChIKey | CZNRMKQBEZJXCZ-OAQYLSRUSA-N |
| XLogP | 2.81 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|