C25H25ClN4O3 — CID 40835819
(5S)-5-(4-chlorophenyl)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 40835819) has the molecular formula C25H25ClN4O3 and a molecular weight of 464.95 g/mol. Its IUPAC name is (5S)-5-(4-chlorophenyl)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (5S)-5-(4-chlorophenyl)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 40835819 |
| Molecular Formula | C25H25ClN4O3 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (5S)-5-(4-chlorophenyl)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | Cc1c(C(O)=C2C(=O)C(=O)N(CCN(C)C)[C@H]2c2ccc(Cl)cc2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C25H25ClN4O3/c1-16-20(15-27-30(16)19-7-5-4-6-8-19)23(31)21-22(17-9-11-18(26)12-10-17)29(14-13-28(2)3)25(33)24(21)32/h4-12,15,22,31H,13-14H2,1-3H3/t22-/m0/s1 |
| InChIKey | HKECDCKZXVMLMJ-QFIPXVFZSA-N |
| XLogP | 3.82 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|