C29H25N3O2 — CID 40836176
(4S)-1-(4-methoxyphenyl)-4-[1-(naphthalen-1-ylmethyl)benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 40836176) has the molecular formula C29H25N3O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is (4S)-1-(4-methoxyphenyl)-4-[1-(naphthalen-1-ylmethyl)benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | (4S)-1-(4-methoxyphenyl)-4-[1-(naphthalen-1-ylmethyl)benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 40836176 |
| Molecular Formula | C29H25N3O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | (4S)-1-(4-methoxyphenyl)-4-[1-(naphthalen-1-ylmethyl)benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | COc1ccc(N2C[C@@H](c3nc4ccccc4n3Cc3cccc4ccccc34)CC2=O)cc1 |
| InChI | InChI=1S/C29H25N3O2/c1-34-24-15-13-23(14-16-24)31-19-22(17-28(31)33)29-30-26-11-4-5-12-27(26)32(29)18-21-9-6-8-20-7-2-3-10-25(20)21/h2-16,22H,17-19H2,1H3/t22-/m0/s1 |
| InChIKey | UIPSSZYRCFHWQF-QFIPXVFZSA-N |
| XLogP | 5.77 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |