C26H28N4O5 — CID 40837849
methyl 4-[(2S)-1-[3-(dimethylamino)propyl]-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 40837849) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is methyl 4-[(2S)-1-[3-(dimethylamino)propyl]-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S)-1-[3-(dimethylamino)propyl]-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 40837849 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | methyl 4-[(2S)-1-[3-(dimethylamino)propyl]-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C(=C(O)c3c(C)nc4ccccn34)C(=O)C(=O)N2CCCN(C)C)cc1 |
| InChI | InChI=1S/C26H28N4O5/c1-16-21(29-14-6-5-8-19(29)27-16)23(31)20-22(17-9-11-18(12-10-17)26(34)35-4)30(25(33)24(20)32)15-7-13-28(2)3/h5-6,8-12,14,22,31H,7,13,15H2,1-4H3/t22-/m0/s1 |
| InChIKey | DNGDUBDUKYGGQC-QFIPXVFZSA-N |
| XLogP | 2.80 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|