C10H10F9NO2 — CID 4083879
2,2,3,3,4,4,5,5,5-nonafluoro-N-(oxolan-2-ylmethyl)pentanamide (PubChem CID 4083879) has the molecular formula C10H10F9NO2 and a molecular weight of 347.18 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-N-(oxolan-2-ylmethyl)pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-(oxolan-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 4083879 |
| Molecular Formula | C10H10F9NO2 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-(oxolan-2-ylmethyl)pentanamide |
| SMILES | O=C(NCC1CCCO1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F9NO2/c11-7(12,6(21)20-4-5-2-1-3-22-5)8(13,14)9(15,16)10(17,18)19/h5H,1-4H2,(H,20,21) |
| InChIKey | KUNKLPGQORJDDW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|