C25H29NO5S3 — CID 40839022
dimethyl 2-[2,2,6,8-tetramethyl-1-[(2S)-2-methylbutanoyl]-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 40839022) has the molecular formula C25H29NO5S3 and a molecular weight of 519.71 g/mol. Its IUPAC name is dimethyl 2-[2,2,6,8-tetramethyl-1-[(2S)-2-methylbutanoyl]-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[2,2,6,8-tetramethyl-1-[(2S)-2-methylbutanoyl]-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 40839022 |
| Molecular Formula | C25H29NO5S3 |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | dimethyl 2-[2,2,6,8-tetramethyl-1-[(2S)-2-methylbutanoyl]-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | CC[C@H](C)C(=O)N1c2c(C)cc(C)cc2C(=C2SC(C(=O)OC)=C(C(=O)OC)S2)C(=S)C1(C)C |
| InChI | InChI=1S/C25H29NO5S3/c1-9-13(3)21(27)26-17-14(4)10-12(2)11-15(17)16(20(32)25(26,5)6)24-33-18(22(28)30-7)19(34-24)23(29)31-8/h10-11,13H,9H2,1-8H3/t13-/m0/s1 |
| InChIKey | XUPXWWRLLLFXDM-ZDUSSCGKSA-N |
| XLogP | 5.55 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|