C7H7BrNO4S2- — CID 4084132
2-[(5-bromothiophen-2-yl)sulfonyl-methylamino]acetate (PubChem CID 4084132) has the molecular formula C7H7BrNO4S2- and a molecular weight of 313.17 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)sulfonyl-methylamino]acetate.
| Compound Name | 2-[(5-bromothiophen-2-yl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 4084132 |
| Molecular Formula | C7H7BrNO4S2- |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 311.90 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)[O-])S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C7H8BrNO4S2/c1-9(4-6(10)11)15(12,13)7-3-2-5(8)14-7/h2-3H,4H2,1H3,(H,10,11)/p-1 |
| InChIKey | YGQMCSUBRSQODB-UHFFFAOYSA-M |
| XLogP | -0.12 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |