C24H21ClN4O6 — CID 40842107
(1S,3S,3aR,6aR)-5-(4-chlorophenyl)-1-(2-hydroxy-3-methoxyphenyl)-3-(1H-imidazol-5-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 40842107) has the molecular formula C24H21ClN4O6 and a molecular weight of 496.91 g/mol. Its IUPAC name is (1S,3S,3aR,6aR)-5-(4-chlorophenyl)-1-(2-hydroxy-3-methoxyphenyl)-3-(1H-imidazol-5-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | (1S,3S,3aR,6aR)-5-(4-chlorophenyl)-1-(2-hydroxy-3-methoxyphenyl)-3-(1H-imidazol-5-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 40842107 |
| Molecular Formula | C24H21ClN4O6 |
| Molecular Weight | 496.91 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | (1S,3S,3aR,6aR)-5-(4-chlorophenyl)-1-(2-hydroxy-3-methoxyphenyl)-3-(1H-imidazol-5-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1cccc([C@H]2N[C@](Cc3cnc[nH]3)(C(=O)O)[C@@H]3C(=O)N(c4ccc(Cl)cc4)C(=O)[C@@H]23)c1O |
| InChI | InChI=1S/C24H21ClN4O6/c1-35-16-4-2-3-15(20(16)30)19-17-18(24(28-19,23(33)34)9-13-10-26-11-27-13)22(32)29(21(17)31)14-7-5-12(25)6-8-14/h2-8,10-11,17-19,28,30H,9H2,1H3,(H,26,27)(H,33,34)/t17-,18+,19-,24+/m1/s1 |
| InChIKey | ZXWDWYSITBIUGA-LFALDJFMSA-N |
| XLogP | 2.29 |
| TPSA | 144.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.91 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|