C22H28ClN3O5S — CID 40844556
4-chloro-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 40844556) has the molecular formula C22H28ClN3O5S and a molecular weight of 482.00 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 40844556 |
| Molecular Formula | C22H28ClN3O5S |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 4-chloro-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NC[C@H](c1ccco1)N1CCCCC1)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C22H28ClN3O5S/c23-18-7-6-17(15-21(18)32(28,29)26-10-13-30-14-11-26)22(27)24-16-19(20-5-4-12-31-20)25-8-2-1-3-9-25/h4-7,12,15,19H,1-3,8-11,13-14,16H2,(H,24,27)/t19-/m1/s1 |
| InChIKey | HHDDOLQCDYQCMB-LJQANCHMSA-N |
| XLogP | 2.91 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.00 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |