C26H15NO6 — CID 40845195
(3R,3'R,12'R)-spiro[1H-indole-3,13'-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),4,6,8,17,19,21-heptaene]-2,11',15'-trione (PubChem CID 40845195) has the molecular formula C26H15NO6 and a molecular weight of 437.41 g/mol. Its IUPAC name is (3R,3'R,12'R)-spiro[1H-indole-3,13'-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),4,6,8,17,19,21-heptaene]-2,11',15'-trione.
| Compound Name | (3R,3'R,12'R)-spiro[1H-indole-3,13'-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),4,6,8,17,19,21-heptaene]-2,11',15'-trione |
|---|---|
| PubChem CID | 40845195 |
| Molecular Formula | C26H15NO6 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | (3R,3'R,12'R)-spiro[1H-indole-3,13'-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),4,6,8,17,19,21-heptaene]-2,11',15'-trione |
| SMILES | O=C1Oc2ccccc2[C@@H]2Oc3c(c(=O)oc4ccccc34)[C@@]3(C(=O)Nc4ccccc43)[C@@H]12 |
| InChI | InChI=1S/C26H15NO6/c28-23-19-21(13-7-1-5-11-17(13)31-23)33-22-14-8-2-6-12-18(14)32-24(29)20(22)26(19)15-9-3-4-10-16(15)27-25(26)30/h1-12,19,21H,(H,27,30)/t19-,21+,26+/m1/s1 |
| InChIKey | SZXKKLUZNAQNME-DYRZZGSRSA-N |
| XLogP | 3.70 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|