C18H22Cl3NO2S — CID 40845451
N-[(1S)-1-(2-adamantyl)ethyl]-2,4,5-trichlorobenzenesulfonamide (PubChem CID 40845451) has the molecular formula C18H22Cl3NO2S and a molecular weight of 422.81 g/mol. Its IUPAC name is N-[(1S)-1-(2-adamantyl)ethyl]-2,4,5-trichlorobenzenesulfonamide.
| Compound Name | N-[(1S)-1-(2-adamantyl)ethyl]-2,4,5-trichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 40845451 |
| Molecular Formula | C18H22Cl3NO2S |
| Molecular Weight | 422.81 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | N-[(1S)-1-(2-adamantyl)ethyl]-2,4,5-trichlorobenzenesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H22Cl3NO2S/c1-9(18-12-3-10-2-11(5-12)6-13(18)4-10)22-25(23,24)17-8-15(20)14(19)7-16(17)21/h7-13,18,22H,2-6H2,1H3/t9-,10?,11?,12?,13?,18?/m0/s1 |
| InChIKey | NEMGAFSQKUFJSM-YIZLWERLSA-N |
| XLogP | 5.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.81 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|