C22H33O2- — CID 40846589
(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate (PubChem CID 40846589) has the molecular formula C22H33O2- and a molecular weight of 329.50 g/mol. Its IUPAC name is (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate.
| Compound Name | (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 40846589 |
| Molecular Formula | C22H33O2- |
| Molecular Weight | 329.50 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)[O-] |
| InChI | InChI=1S/C22H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-21H2,1H3,(H,23,24)/p-1/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | YUFFSWGQGVEMMI-JLNKQSITSA-M |
| XLogP | 5.44 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|